CAS 54104-37-9 appears in our catalog under these names: 2-(3-Chloropropyl)-1H-1,3-benzodiazole hydrochloride, 95%, 2-(3-Chloropropyl)-1H-1,3-benzodiazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3-chloropropyl)-1H-benzimidazole;hydrochloride (CAS 54104-37-9) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2-(3-chloropropyl)-1H-benzimidazole;hydrochloride. InChIKey: QKNGJODTRVZRDR-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2-(3-chloropropyl)-1H-benzimidazole;hydrochloride |
| InChIKey | QKNGJODTRVZRDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CCCCl.Cl |
Computed by PubChem (NCBI)