CAS 5422-63-9 appears in our catalog under these names: N-Formyl Benzocaine, N-Formyl Benzocaine, >95% (HPLC), Ethyl 4-Formamidobenzoate (N-Formylbenzocaine), Ethyl 4–Formamidobenzoate, Ethyl 4-formamidobenzoate 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 100mg, 1g, 25mg, 25g, 5g, 10g, 100g.
Ethyl 4-formamidobenzoate (CAS 5422-63-9) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: ethyl 4-formamidobenzoate. InChIKey: XXNAVWORVSFFAD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | ethyl 4-formamidobenzoate |
| InChIKey | XXNAVWORVSFFAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC=O |
Computed by PubChem (NCBI)