CAS 5422-92-4 appears in our catalog under these names: 4-Nitro-2-phenoxyaniline, 4-Nitro-2-phenoxyaniline, >95% (HPLC), Nimesulide EP Impurity D, Nimesulide impurity 3. Offered by: Mikromol, Biosynth, TRC, Chemat Brand, MedChemExpress. Available pack sizes: 25mg, 100mg, 0,5g, 500mg, 50mg, on request, Get quote.
4-nitro-2-phenoxyaniline (CAS 5422-92-4) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 4-nitro-2-phenoxyaniline. InChIKey: CGQKBVHAWXBMCL-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-nitro-2-phenoxyaniline |
| InChIKey | CGQKBVHAWXBMCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=CC(=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)