CAS 5434-47-9 appears in our catalog under these names: 5–Bromo–6–bromomethyl–1,3–benzodioxole, 5-Bromo-6-bromomethyl-1,3-benzodioxole, 5-Bromo-6-(bromomethyl)benzo[d][1,3]dioxole 97%, 5-BROMO-6-(BROMOMETHYL)BENZO[D][1,3]DIOXOLE, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
5-bromo-6-(bromomethyl)-1,3-benzodioxole (CAS 5434-47-9) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 5-bromo-6-(bromomethyl)-1,3-benzodioxole. InChIKey: FDCXAYVCUJDBJU-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 5-bromo-6-(bromomethyl)-1,3-benzodioxole |
| InChIKey | FDCXAYVCUJDBJU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CBr)Br |
Computed by PubChem (NCBI)