CAS 5441-60-1 appears in our catalog under these names: N-Methyl-1-(2-nitrophenyl)methanamine hydrochloride, 95%, N-Methyl-n-(2-nitrobenzyl)amine hydrochloride, 95%, N-Methyl-2-nitrobenzylamine Hydrochloride, N-Methyl-N-(2-Nitrobenzyl)Amine Hydrochloride, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 0,25g, 2,5g, 100mg, 250mg.
N-methyl-1-(2-nitrophenyl)methanamine;hydrochloride (CAS 5441-60-1) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: N-methyl-1-(2-nitrophenyl)methanamine;hydrochloride. InChIKey: NCDRLRZMVFXZPA-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | N-methyl-1-(2-nitrophenyl)methanamine;hydrochloride |
| InChIKey | NCDRLRZMVFXZPA-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=CC=C1[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)