Products 54445-02-2
CAS 54445-02-2 appears in our catalog under these names: 7-Chlorochroman-3-amine hydrochloride, 95%, 95%, 7-Chlorochroman-3-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
7-chloro-3,4-dihydro-2H-chromen-3-amine;hydrochloride (CAS 54445-02-2) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 7-chloro-3,4-dihydro-2H-chromen-3-amine;hydrochloride. InChIKey: AOGOCJVZCAKDON-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| InChIKey | AOGOCJVZCAKDON-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=CC(=C2)Cl)N.Cl |
Computed by PubChem (NCBI)