CAS 544480-14-0 appears in our catalog under these names: (2R,3S)-2-((tert-Butoxycarbonyl)amino)-3-methoxybutanoic acid, 98%, (2R,3S)-2-((tert-Butoxycarbonyl)amino)-3-methoxybutanoic acid, 97%, 97%, N-(tert-Butoxycarbonyl)-O-methyl-D-threonine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2R,3S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 544480-14-0) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: (2R,3S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VWSUOKFUIPMDDX-NKWVEPMBSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2R,3S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VWSUOKFUIPMDDX-NKWVEPMBSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)