CAS 630424-73-6 is the registry number for Boc-Allo-Thr(Me)-OH 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S,3S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 630424-73-6) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: (2S,3S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VWSUOKFUIPMDDX-BQBZGAKWSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2S,3S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VWSUOKFUIPMDDX-BQBZGAKWSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)