CAS 545375-30-2 appears in our catalog under these names: 2-Aminoethyl benzoate hydrochloride, 95%, Ethanolamine benzoate hydrochloride, 95%, Ethanolamine benzoate hydrochloride, 98+% . Offered by: AmBeed, Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 100g, 5g.
2-aminoethyl benzoate;hydrochloride (CAS 545375-30-2) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-aminoethyl benzoate;hydrochloride. InChIKey: ZXTMLOSVFWKYCL-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-aminoethyl benzoate;hydrochloride |
| InChIKey | ZXTMLOSVFWKYCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCN.Cl |
Computed by PubChem (NCBI)