Products 545393-80-4
CAS 545393-80-4 is the registry number for (2E)-3-(4-Cyclopropylphenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 1g, 0,5g.
(E)-3-(4-cyclopropylphenyl)prop-2-enoic acid (CAS 545393-80-4) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: (E)-3-(4-cyclopropylphenyl)prop-2-enoic acid. InChIKey: ZEKSWKQALDVANW-FPYGCLRLSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (E)-3-(4-cyclopropylphenyl)prop-2-enoic acid |
| InChIKey | ZEKSWKQALDVANW-FPYGCLRLSA-N |
| SMILES | C1CC1C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)