Products 5454-35-3
CAS 5454-35-3 appears in our catalog under these names: 1，3–Diphenylpropan–1–amine hydrochloride, 1,3-Diphenylpropan-1-amine hydrochloride, 1,3-diphenylpropan-1-amine hydrochloride, 98%, 98%, 1,3-Diphenylpropan-1-amine hydrochloride, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 5g, 250mg.
1,3-diphenylpropan-1-amine;hydrochloride (CAS 5454-35-3) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: 1,3-diphenylpropan-1-amine;hydrochloride. InChIKey: MTYYXUIJVCIFHK-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | 1,3-diphenylpropan-1-amine;hydrochloride |
| InChIKey | MTYYXUIJVCIFHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)