CAS 76739-66-7 appears in our catalog under these names: (2R,3R,4R)-2-Methyl-3,4-dihydro-2H-pyran-3,4-diyl diacetate, 98%, D-Rhamnal diacetate, 98%, 98%, D-Rhamnal diacetate, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
[(2R,3R,4R)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate (CAS 76739-66-7) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: [(2R,3R,4R)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate. InChIKey: NDEGMKQAZZBNBB-BDODKLCJSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | [(2R,3R,4R)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
| InChIKey | NDEGMKQAZZBNBB-BDODKLCJSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H](C=CO1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)