CAS 5473-15-4 appears in our catalog under these names: 4-(4-Acetamidophenyl)-4-oxobutanoic acid, 4-(4-Acetamidophenyl)-4-oxobutanoic acid, 95%, 4-(4-Acetamidophenyl)-4-oxobutanoic acid, 97%, 4-(4-Acetamidophenyl)-4-oxobutanoic acid, min. 95 %, 50 mg, 4-(4-Acetamidophenyl)-4-oxobutanoic acid, min. 95 %, 100 mg. Offered by: Biosynth, Combi-blocks, AmBeed, Roth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg, 1g, 5g.
4-(4-acetamidophenyl)-4-oxobutanoic acid (CAS 5473-15-4) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 4-(4-acetamidophenyl)-4-oxobutanoic acid. InChIKey: GVHXQQMLYHDQBE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4-(4-acetamidophenyl)-4-oxobutanoic acid |
| InChIKey | GVHXQQMLYHDQBE-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)