CAS 54768-47-7 is the registry number for 3-Chloro-4-nitro-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-chloro-4-nitro-2H-indazole (CAS 54768-47-7) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 3-chloro-4-nitro-2H-indazole. InChIKey: GUGAGLJJSMABRQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 3-chloro-4-nitro-2H-indazole |
| InChIKey | GUGAGLJJSMABRQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)