CAS 54798-92-4 is the registry number for 2-Phenyl-2H-1,2,3,4-tetrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-phenyltetrazole-5-carboxylic acid (CAS 54798-92-4) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 2-phenyltetrazole-5-carboxylic acid. InChIKey: YFIIOEOZTVRRDK-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2-phenyltetrazole-5-carboxylic acid |
| InChIKey | YFIIOEOZTVRRDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)