CAS 54941-44-5 appears in our catalog under these names: 2-(4-Methyl-3-nitrophenyl)acetic acid, 95%+, 95%+, 4-METHYL-3-NITROPHENYLACETIc acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
2-(4-methyl-3-nitrophenyl)acetic acid (CAS 54941-44-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-methyl-3-nitrophenyl)acetic acid. InChIKey: WZNKBDUWSKJHEG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-methyl-3-nitrophenyl)acetic acid |
| InChIKey | WZNKBDUWSKJHEG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)