Products 55167-53-8
CAS 55167-53-8 is the registry number for rac-(1R,2S)-1-Phenylcyclopropane-1,2-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,2S)-1-phenylcyclopropane-1,2-dicarboxylic acid (CAS 55167-53-8) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: cis-(1R,2S)-1-phenylcyclopropane-1,2-dicarboxylic acid. InChIKey: CPBWKVACBJABJR-KCJUWKMLSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | cis-(1R,2S)-1-phenylcyclopropane-1,2-dicarboxylic acid |
| InChIKey | CPBWKVACBJABJR-KCJUWKMLSA-N |
| SMILES | C1[C@@H]([C@]1(C2=CC=CC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)