Products 55239-35-5
CAS 55239-35-5 is the registry number for (3-Chlorophenyl)(methyl)carbamic chloride 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
N-(3-chlorophenyl)-N-methylcarbamoyl chloride (CAS 55239-35-5) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: N-(3-chlorophenyl)-N-methylcarbamoyl chloride. InChIKey: MQTLFKGDEOQCQK-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | N-(3-chlorophenyl)-N-methylcarbamoyl chloride |
| InChIKey | MQTLFKGDEOQCQK-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=CC=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)