Products 55320-96-2
CAS 55320-96-2 is the registry number for (E)-5-Phenylpent-2-enoic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
(E)-5-phenylpent-2-enoic acid (CAS 55320-96-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-5-phenylpent-2-enoic acid. InChIKey: IATNQCGERGDVDN-WEVVVXLNSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-5-phenylpent-2-enoic acid |
| InChIKey | IATNQCGERGDVDN-WEVVVXLNSA-N |
| SMILES | C1=CC=C(C=C1)CC/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(E)-5-phenylpent-2-enoic acid, (E)-5-Phenyl-2-pentenoic acid, (2E)-5-phenylpent-2-enoic acid, 2-Pentenoic acid, 5-phenyl-, (E)-, 5-Phenyl-2E-pentenoic acid, 5-Phenyl-pent-2-enoic acid, (2E)-5-phenyl2-Pentenoicacid, trans-5-phenyl-2-pentenoic acid, (2E)-5-Phenylpent-2-enoicacid,E, (2E)-5-Phenyl-2-pentenoic acid #