CAS 55326-07-3 is the registry number for 1,3,6-Trimethyl-5-nitropyrimidine-2,4(1H,3H)-dione. Offered by: Fluorochem. Available pack sizes: 100mg.
1,3,6-trimethyl-5-nitropyrimidine-2,4-dione (CAS 55326-07-3) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 1,3,6-trimethyl-5-nitropyrimidine-2,4-dione. InChIKey: OSTDULKDQDIIKB-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 1,3,6-trimethyl-5-nitropyrimidine-2,4-dione |
| InChIKey | OSTDULKDQDIIKB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C(=O)N1C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)