Products 55525-92-3
CAS 55525-92-3 appears in our catalog under these names: Olanzapine Impurity 30, 2-amino-4-ethyl-5-methylbenzene-1,3-dicarbonitrile. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-4-ethyl-5-methylbenzene-1,3-dicarbonitrile (CAS 55525-92-3) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-amino-4-ethyl-5-methylbenzene-1,3-dicarbonitrile. InChIKey: QFXFKVRTUVXIJH-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-amino-4-ethyl-5-methylbenzene-1,3-dicarbonitrile |
| InChIKey | QFXFKVRTUVXIJH-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1C)C#N)N)C#N |
Computed by PubChem (NCBI)