CAS 55579-90-3 is the registry number for 7-Chloro-3,4-dihydro-2h-benzo[b]oxepin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
7-chloro-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 55579-90-3) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 7-chloro-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: SWNUBBODNFTNPC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | SWNUBBODNFTNPC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C2)Cl)OC1 |
Computed by PubChem (NCBI)