CAS 556828-95-6 is the registry number for Methyl (2Z)-2-(acetylamino)-3-(1,1′-biphenyl)-4-yl-2-propenoate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
Methyl (Z)-2-acetamido-3-(4-phenylphenyl)prop-2-enoate (CAS 556828-95-6) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: methyl (Z)-2-acetamido-3-(4-phenylphenyl)prop-2-enoate. InChIKey: IENQUVITARYLDT-ATVHPVEESA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | methyl (Z)-2-acetamido-3-(4-phenylphenyl)prop-2-enoate |
| InChIKey | IENQUVITARYLDT-ATVHPVEESA-N |
| SMILES | CC(=O)N/C(=C\C1=CC=C(C=C1)C2=CC=CC=C2)/C(=O)OC |
Computed by PubChem (NCBI)