CAS 55815-63-9 appears in our catalog under these names: 6H-Benzo(c)chromen-3-ol, 97%, 6H-Benzo[c]chromen-3-ol, 95%, 95%, 6H-Benzo[c]chromen-3-ol, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
6H-benzo[c]chromen-3-ol (CAS 55815-63-9) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 6H-benzo[c]chromen-3-ol. InChIKey: GPQSNPDIFXIWFN-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 6H-benzo[c]chromen-3-ol |
| InChIKey | GPQSNPDIFXIWFN-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C(O1)C=C(C=C3)O |
Computed by PubChem (NCBI)