CAS 55931-21-0 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)-2-hydroxyacetonitrile, 95%, 2-(2,6-Dichlorophenyl)-2-hydroxyacetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
2-(2,6-dichlorophenyl)-2-hydroxyacetonitrile (CAS 55931-21-0) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-2-hydroxyacetonitrile. InChIKey: PQZULIDMYBWYFO-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-2-hydroxyacetonitrile |
| InChIKey | PQZULIDMYBWYFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C#N)O)Cl |
Computed by PubChem (NCBI)