Products 56032-01-0
CAS 56032-01-0 is the registry number for Ethyl 4,6-dichloro-2-pyrimidinecarboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
Ethyl 4,6-dichloropyrimidine-2-carboxylate (CAS 56032-01-0) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: ethyl 4,6-dichloropyrimidine-2-carboxylate. InChIKey: KRCJVOFXNWPEKL-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | ethyl 4,6-dichloropyrimidine-2-carboxylate |
| InChIKey | KRCJVOFXNWPEKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)