Products 56121-44-9
CAS 56121-44-9 is the registry number for 4-O-Methylhelichrysetin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, Get quote.
(E)-1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 56121-44-9) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: (E)-1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: YROJPKUFDFWHAO-VMPITWQZSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (E)-1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | YROJPKUFDFWHAO-VMPITWQZSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2OC)O)O |
Computed by PubChem (NCBI)