CAS 5622-36-6 appears in our catalog under these names: Methyl 2–(quinolin–6–yl)acetate, Methyl 2-(quinolin-6-yl)acetate, 95%, Methyl 2-(quinolin-6-yl)acetate, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100mg.
Methyl 2-quinolin-6-ylacetate (CAS 5622-36-6) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 2-quinolin-6-ylacetate. InChIKey: PCUOFKCRVNHDEB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 2-quinolin-6-ylacetate |
| InChIKey | PCUOFKCRVNHDEB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC2=C(C=C1)N=CC=C2 |
Computed by PubChem (NCBI)