Products 56464-74-5
CAS 56464-74-5 appears in our catalog under these names: 1-(2-Chlorophenyl)-1,3-butanedione, 1-(2-Chlorophenyl)butane-1,3-dione 98%, 1-(2-Chlorophenyl)butane-1,3-dione, 95%, 1-(2-chlorophenyl)-3-hydroxybut-2-en-1-one, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
1-(2-chlorophenyl)butane-1,3-dione (CAS 56464-74-5) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 1-(2-chlorophenyl)butane-1,3-dione. InChIKey: CYPYOGOPKDBEFY-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-(2-chlorophenyl)butane-1,3-dione |
| InChIKey | CYPYOGOPKDBEFY-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)