CAS 56496-88-9 is the registry number for 2-Methyl-5-methoxy-p-phenylenediamine Dihydrochloride. Offered by: TRC. Available pack sizes: 5g.
2-methoxy-5-methylbenzene-1,4-diamine;dihydrochloride (CAS 56496-88-9) is a chemical compound with the molecular formula C8H14Cl2N2O and a molecular weight of 225.11 g/mol. IUPAC name: 2-methoxy-5-methylbenzene-1,4-diamine;dihydrochloride. InChIKey: MAUAYDDABCDBRG-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 2-methoxy-5-methylbenzene-1,4-diamine;dihydrochloride |
| InChIKey | MAUAYDDABCDBRG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)OC)N.Cl.Cl |
Computed by PubChem (NCBI)