Products 56536-24-4
CAS 56536-24-4 appears in our catalog under these names: 1,6-Dimethyl-1H-pyrazolo[4,3-d]pyrimidine-5,7(4H,6H)-dione, 97%, 97%, 1,6-Dimethyl-1H-pyrazolo[4,3-d]pyrimidine-5,7(4H,6H)-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
1,6-dimethyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione (CAS 56536-24-4) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 1,6-dimethyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione. InChIKey: DOTCEVYMJKRBTL-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,6-dimethyl-4H-pyrazolo[4,5-d]pyrimidine-5,7-dione |
| InChIKey | DOTCEVYMJKRBTL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)NC(=O)N(C2=O)C |
Computed by PubChem (NCBI)