CAS 56613-61-7 appears in our catalog under these names: H–D–Phe(4–NO2)–OH, H-D-Phe(4-NO2)-OH*H2O, 4-Nitro-D-phenylalanine, >97.0%(HPLC)(T), 4-Nitro-D-phenylalanine hydrate, 4-Nitro-D-phenylalanine, 98%, 98%. Offered by: GLPBio, Iris Biotech, TCI, Biosynth, Chemat. Available pack sizes: 100g, 1g, 5g, 25g, 10g, 50g, 500g, 100 g.
(2R)-2-amino-3-(4-nitrophenyl)propanoic acid (CAS 56613-61-7) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (2R)-2-amino-3-(4-nitrophenyl)propanoic acid. InChIKey: GTVVZTAFGPQSPC-MRVPVSSYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-nitrophenyl)propanoic acid |
| InChIKey | GTVVZTAFGPQSPC-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)