Products 5676-62-0
CAS 5676-62-0 is the registry number for (Z)-3-(4-Chlorophenyl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-(4-chlorophenyl)prop-2-enoic acid (CAS 5676-62-0) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: (Z)-3-(4-chlorophenyl)prop-2-enoic acid. InChIKey: GXLIFJYFGMHYDY-UTCJRWHESA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | (Z)-3-(4-chlorophenyl)prop-2-enoic acid |
| InChIKey | GXLIFJYFGMHYDY-UTCJRWHESA-N |
| SMILES | C1=CC(=CC=C1/C=C\C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
cis-4-Chlorocinnamic acid, (Z)-3-(4-Chlorophenyl)acrylic acid, 4-Chlorocinnamic acid, (Z)-, z-4-chlorocinnamic acid, cis-p-Chlorocinnamic acid, (Z)-p-Chlorocinnamic acid, (Z)-4-Chlorocinnamic acid, Cinnamic acid, p-chloro-, cis-, GXLIFJYFGMHYDY-UTCJRWHESA-N, (2Z)-3-(4-Chlorophenyl)-2-propenoic acid