CAS 56961-26-3 appears in our catalog under these names: Benzoic acid, 2–bromo–3–chloro–,2–Brom–3–chlorobenzoic acid, 2-Bromo-3-chlorobenzoic acid, 95%, 2-Bromo-3-chlorobenzoic acid, 98%, 2-Bromo-3-chlorobenzoic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg.
2-bromo-3-chlorobenzoic acid (CAS 56961-26-3) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 2-bromo-3-chlorobenzoic acid. InChIKey: SITHNMNGOHVILG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 2-bromo-3-chlorobenzoic acid |
| InChIKey | SITHNMNGOHVILG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)