CAS 56964-05-7 is the registry number for 2-Phenylcyclohexane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenylcyclohexane-1,3-dione (CAS 56964-05-7) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 2-phenylcyclohexane-1,3-dione. InChIKey: BMLKSMGUVMXKQS-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 2-phenylcyclohexane-1,3-dione |
| InChIKey | BMLKSMGUVMXKQS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C(C(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)