Products 5699-91-2
CAS 5699-91-2 is the registry number for 1,4-Diazaspiro(5.5)undecane-3,5-dione. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1,4-diazaspiro[5.5]undecane-3,5-dione (CAS 5699-91-2) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 1,4-diazaspiro[5.5]undecane-3,5-dione. InChIKey: ZQIMXZJALAYSTB-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1,4-diazaspiro[5.5]undecane-3,5-dione |
| InChIKey | ZQIMXZJALAYSTB-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)NC(=O)CN2 |
Computed by PubChem (NCBI)