Products 57102-98-4
CAS 57102-98-4 appears in our catalog under these names: 9-ethyl-9H-carbazole-3-carboxylic acid, 98%, 98%, 9-Ethyl-9H-carbazole-3-carboxylic acid, 95%, 9-Ethyl-9H-carbazole-3-carboxylic Acid, >95% (HPLC), 9-Ethyl-9H-carbazole-3-carboxylic acid, 98%. Offered by: Chemat, Combi-blocks, TRC, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 10mg, 50mg.
9-ethylcarbazole-3-carboxylic acid (CAS 57102-98-4) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 9-ethylcarbazole-3-carboxylic acid. InChIKey: QZQNANUJNRAGPZ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 9-ethylcarbazole-3-carboxylic acid |
| InChIKey | QZQNANUJNRAGPZ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C(=O)O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)
Synonyms:
9-ethyl-9H-carbazole-3-carboxylic acid, 9-ethylcarbazole-3-carboxylic acid, 9-ethyl-9 h-carbazole-3-carboxylic acid, 9H-Carbazole-3-carboxylic acid, 9-ethyl-, N-ethylcarbazole-3-carboxylic acid, 9-ethyl-3-carbazolecarboxylic acid, 9-ethyl-carbazole-3-carboxylic acid, 9-ethyl-9H-carbazole-3-carboxylicacid