Products 57113-89-0
CAS 57113-89-0 appears in our catalog under these names: Methyl 2-amino-6-nitrobenzoate, 95%, Methyl 2–Amino–6–nitrobenzoate, Methyl 2-Amino-6-nitrobenzoate, 95%, 95%, Methyl 2-amino-6-nitrobenzoate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl 2-amino-6-nitrobenzoate (CAS 57113-89-0) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 2-amino-6-nitrobenzoate. InChIKey: NFPMHGVGDWXWRJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 2-amino-6-nitrobenzoate |
| InChIKey | NFPMHGVGDWXWRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)