CAS 57369-19-4 appears in our catalog under these names: 7-Bromo-1-azatricyclo(7.3.1.0,5,13)trideca-5,7,9(13)-trien-2-one, 95%, 7-Bromo-1-azatricyclo(7.3.1.0,5,13)trideca-5,7,9(13)-trien-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one (CAS 57369-19-4) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one. InChIKey: CCFWHRWMFHROJU-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
| InChIKey | CCFWHRWMFHROJU-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC(=C2)Br)CCC(=O)N3C1 |
Computed by PubChem (NCBI)