CAS 57543-62-1 appears in our catalog under these names: 6-Methoxy-2h-chromene-3-carboxylic acid, 95%, 6-Methoxy-2H-chromene-3-carboxylic acid, 6-Methoxy-2H-chromene-3-carboxylic acid, 98%, 98%, 6-Methoxy-2H-chromene-3-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 500mg, 2,5g, 100mg, 250mg, 1g, 5g, 10g.
6-methoxy-2H-chromene-3-carboxylic acid (CAS 57543-62-1) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 6-methoxy-2H-chromene-3-carboxylic acid. InChIKey: VOOCQPOSPBMQSK-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 6-methoxy-2H-chromene-3-carboxylic acid |
| InChIKey | VOOCQPOSPBMQSK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC(=C2)C(=O)O |
Computed by PubChem (NCBI)