CAS 57609-64-0 appears in our catalog under these names: Trimethylene Bis(4–aminobenzoate), Trimethylene Bis(4-aminobenzoate), >98.0%(HPLC)(T), Propane-1,3-Diyl Bis(4-Aminobenzoate), 98%, 98%, Propane-1,3-diyl bis(4-aminobenzoate), 98%, Propane-1,3-diyl bis(4-aminobenzoate) 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 500g, 25g, 1kg, 5g, 1000g.
3-(4-aminobenzoyl)oxypropyl 4-aminobenzoate (CAS 57609-64-0) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: 3-(4-aminobenzoyl)oxypropyl 4-aminobenzoate. InChIKey: YPACMOORZSDQDQ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | 3-(4-aminobenzoyl)oxypropyl 4-aminobenzoate |
| InChIKey | YPACMOORZSDQDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OCCCOC(=O)C2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)