Products 5765-65-1
CAS 5765-65-1 appears in our catalog under these names: 4-Benzoyloxymorpholine, 95-<97%, Morpholino benzoate 95%, Benzoic acid morpholin-4-yl ester, 97%, 97%, Benzoic acid morpholin-4-yl ester, 98%. Offered by: Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 250mg.
Morpholin-4-yl benzoate (CAS 5765-65-1) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: morpholin-4-yl benzoate. InChIKey: ZTURCWOWVLVNPE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | morpholin-4-yl benzoate |
| InChIKey | ZTURCWOWVLVNPE-UHFFFAOYSA-N |
| SMILES | C1COCCN1OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)