CAS 577967-83-0 is the registry number for 2,3-Dichloro-5-(piperidine-1-carbonyl)pyridine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(5,6-dichloro-3-pyridinyl)-piperidin-1-ylmethanone (CAS 577967-83-0) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: (5,6-dichloro-3-pyridinyl)-piperidin-1-ylmethanone. InChIKey: AXSJDGHQFMXGFL-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | (5,6-dichloro-3-pyridinyl)-piperidin-1-ylmethanone |
| InChIKey | AXSJDGHQFMXGFL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=C(N=C2)Cl)Cl |
Computed by PubChem (NCBI)