CAS 57899-16-8 is the registry number for 5-(Chloromethyl)-2,2-dimethyl-2,3-dihydro-1-benzofuran, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran (CAS 57899-16-8) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 5-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran. InChIKey: DVRYIRZASBSPAB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 5-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran |
| InChIKey | DVRYIRZASBSPAB-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C=CC(=C2)CCl)C |
Computed by PubChem (NCBI)