CAS 57944-44-2 appears in our catalog under these names: 7-Ethoxy-2-naphthalenol, 98%, 7-Ethoxy-2-naphthalenol 98%, 7-Ethoxy-2-naphthalenol, 97%, 7-Ethoxy-2-naphthalenol, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
7-ethoxynaphthalen-2-ol (CAS 57944-44-2) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 7-ethoxynaphthalen-2-ol. InChIKey: JUCJMPYFZSOWCE-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 7-ethoxynaphthalen-2-ol |
| InChIKey | JUCJMPYFZSOWCE-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=CC(=C2)O)C=C1 |
Computed by PubChem (NCBI)