CAS 58095-77-5 is the registry number for (E)-3,4-Methylenedioxycinnamaldehyde. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
(E)-3-(1,3-benzodioxol-5-yl)prop-2-enal (CAS 58095-77-5) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-5-yl)prop-2-enal. InChIKey: HZUFMSJUNLSDSZ-OWOJBTEDSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-5-yl)prop-2-enal |
| InChIKey | HZUFMSJUNLSDSZ-OWOJBTEDSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C=O |
Computed by PubChem (NCBI)