Products 58096-66-5
CAS 58096-66-5 is the registry number for 4′,5′-Didehydro-2′,5′-dideoxyuridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,4S)-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione (CAS 58096-66-5) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 1-[(2R,4S)-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: GWUGJFCGJLMLER-POYBYMJQSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 1-[(2R,4S)-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | GWUGJFCGJLMLER-POYBYMJQSA-N |
| SMILES | C=C1[C@H](C[C@@H](O1)N2C=CC(=O)NC2=O)O |
Computed by PubChem (NCBI)