CAS 58139-11-0 is the registry number for 2,3'-Difluorobenzophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2-fluorophenyl)-(3-fluorophenyl)methanone (CAS 58139-11-0) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2-fluorophenyl)-(3-fluorophenyl)methanone. InChIKey: SGTSFZMOEFGUPQ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2-fluorophenyl)-(3-fluorophenyl)methanone |
| InChIKey | SGTSFZMOEFGUPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=CC=C2)F)F |
Computed by PubChem (NCBI)