CAS 5814-06-2 appears in our catalog under these names: 2,4-dichlorobenzohydrazide, 95%, 2,4-Dichlorobenzohydrazide, >98.0%(GC)(T), 2,4-Dichlorobenzohydrazide, 98%, 98%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
2,4-dichlorobenzohydrazide (CAS 5814-06-2) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,4-dichlorobenzohydrazide. InChIKey: QOJQHOGSXXSMKX-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,4-dichlorobenzohydrazide |
| InChIKey | QOJQHOGSXXSMKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)NN |
Computed by PubChem (NCBI)