CAS 58143-00-3 appears in our catalog under these names: 5–AMINOISOQUINOLINE DIHYDROCHLORIDE, Isoquinolin-5-amine dihydrochloride, ≥97%, ≥97%, 5-AMINOISOQUINOLINE DIHYDROCHLORIDE, ≥97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
Isoquinolin-5-amine;dihydrochloride (CAS 58143-00-3) is a chemical compound with the molecular formula C9H10Cl2N2 and a molecular weight of 217.09 g/mol. IUPAC name: isoquinolin-5-amine;dihydrochloride. InChIKey: YIFMEJRWWQEKPJ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | isoquinolin-5-amine;dihydrochloride |
| InChIKey | YIFMEJRWWQEKPJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)N.Cl.Cl |
Computed by PubChem (NCBI)